CAS 1216798-07-0 is the registry number for N-Carbamoyl-2-fluoro-Beta-alanine-13C3, >95% (HPLC). Offered by: TRC. Available pack sizes: 0,25mg, 1mg.
3-(carbamoylamino)-2-fluoro(1,2,3-13C3)propanoic acid (CAS 1216798-07-0) is a chemical compound with the molecular formula C4H7FN2O3 and a molecular weight of 153.09 g/mol. IUPAC name: 3-(carbamoylamino)-2-fluoro(1,2,3-13C3)propanoic acid. InChIKey: FKTHAKABFGARQH-VMIGTVKRSA-N.
| Molecular formula | C4H7FN2O3 |
|---|---|
| Molecular weight | 153.09 g/mol |
| IUPAC name | 3-(carbamoylamino)-2-fluoro(1,2,3-13C3)propanoic acid |
| InChIKey | FKTHAKABFGARQH-VMIGTVKRSA-N |
| SMILES | [13CH2]([13CH]([13C](=O)O)F)NC(=O)N |
Computed by PubChem (NCBI)