CAS 1216817-27-4 appears in our catalog under these names: 3-(2-(Benzyl(methyl)amino)ethyl) 5-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate hydrochloride, 98%, Nicardipine Impurity 1 HCl(Nicardipine EP Impurity A HCl), Nicardipine EP Impurity A HCl (Dehydro Nicardipine HCl), Dehydro Nicardipine Hydrochloride. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate;hydrochloride (CAS 1216817-27-4) is a chemical compound with the molecular formula C26H28ClN3O6 and a molecular weight of 514.0 g/mol. IUPAC name: 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate;hydrochloride. InChIKey: PTHKWJBMEAIYJV-UHFFFAOYSA-N.
| Molecular formula | C26H28ClN3O6 |
|---|---|
| Molecular weight | 514.0 g/mol |
| IUPAC name | 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)pyridine-3,5-dicarboxylate;hydrochloride |
| InChIKey | PTHKWJBMEAIYJV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)C(=O)OCCN(C)CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC.Cl |
Computed by PubChem (NCBI)