CAS 1216822-66-0 is the registry number for 1,8-Cineol-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 5mg, 10mg, 50mg.
4,6,6-trideuterio-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane (CAS 1216822-66-0) is a chemical compound with the molecular formula C10H18O and a molecular weight of 157.27 g/mol. IUPAC name: 4,6,6-trideuterio-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane. InChIKey: WEEGYLXZBRQIMU-OJYSAGIRSA-N.
| Molecular formula | C10H18O |
|---|---|
| Molecular weight | 157.27 g/mol |
| IUPAC name | 4,6,6-trideuterio-1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane |
| InChIKey | WEEGYLXZBRQIMU-OJYSAGIRSA-N |
| SMILES | [2H]C1(CC2(CCC1(OC2(C)C)C)[2H])[2H] |
Computed by PubChem (NCBI)