Products 1216840-17-3
CAS 1216840-17-3 is the registry number for Aspericin C. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl (E)-6-[(2S,5R,6R)-5-hydroxy-5,6-dimethyloxan-2-yl]-2,4-dimethylhept-5-enoate (CAS 1216840-17-3) is a chemical compound with the molecular formula C17H30O4 and a molecular weight of 298.4 g/mol. IUPAC name: methyl (E)-6-[(2S,5R,6R)-5-hydroxy-5,6-dimethyloxan-2-yl]-2,4-dimethylhept-5-enoate. InChIKey: VRKCGOOZETWBGJ-IHSAQGCHSA-N.
| Molecular formula | C17H30O4 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | methyl (E)-6-[(2S,5R,6R)-5-hydroxy-5,6-dimethyloxan-2-yl]-2,4-dimethylhept-5-enoate |
| InChIKey | VRKCGOOZETWBGJ-IHSAQGCHSA-N |
| SMILES | C[C@@H]1[C@](CC[C@H](O1)/C(=C/C(C)CC(C)C(=O)OC)/C)(C)O |
Computed by PubChem (NCBI)
Synonyms:
Aspericin C