CAS 1216850-33-7 appears in our catalog under these names: Desethyldesisopropyl Atrazine-13C3, >95% (HPLC), Desethyl–desisopropyl Atrazine–13C3, 6-CHLORO-2,4-DIAMINO-1,3,5-TRIAZINE-13C3, 6-Chloro-1,3,5-triazine-2,4-diamine-13C3, 6-Chloro-1,3,5-triazine-2,4-diamine-13C3. Offered by: TRC, GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5 mg, 10 mg, 1 mg, 1x1ml, 1x10mg.
6-chloro-(2,4,6-13C3)1,3,5-triazine-2,4-diamine (CAS 1216850-33-7) is a chemical compound with the molecular formula C3H4ClN5 and a molecular weight of 148.53 g/mol. IUPAC name: 6-chloro-(2,4,6-13C3)1,3,5-triazine-2,4-diamine. InChIKey: FVFVNNKYKYZTJU-VMIGTVKRSA-N.
| Molecular formula | C3H4ClN5 |
|---|---|
| Molecular weight | 148.53 g/mol |
| IUPAC name | 6-chloro-(2,4,6-13C3)1,3,5-triazine-2,4-diamine |
| InChIKey | FVFVNNKYKYZTJU-VMIGTVKRSA-N |
| SMILES | [13C]1(=N[13C](=N[13C](=N1)Cl)N)N |
Computed by PubChem (NCBI)