CAS 1216909-33-9 appears in our catalog under these names: 9–Mesityl–2,7,10–trimethylacridinium Perchlorate, 9-MESITYL-2,7,10-TRIMETHYLACRIDINIUM PERCHLORATE, 95%, 9-Mesityl-2,7,10-trimethylacridinium Perchlorate, >98.0%(HPLC), 9-Mesityl-2,7,10-trimethylacridinium Perchlorate, 95%, 95%, 9-Mesityl-2,7,10-trimethyl-acridinium perchlorate, chembeads 0.005μmol/mg, 95%. Offered by: GLPBio, Fluorochem, TCI, Chemat. Available pack sizes: 250mg, 50mg, 1g, 100mg, 5g.
2,7,10-trimethyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate (CAS 1216909-33-9) is a chemical compound with the molecular formula C25H26ClNO4 and a molecular weight of 439.9 g/mol. IUPAC name: 2,7,10-trimethyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate. InChIKey: VDNXOHCMBBOSPE-UHFFFAOYSA-M.
| Molecular formula | C25H26ClNO4 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | 2,7,10-trimethyl-9-(2,4,6-trimethylphenyl)acridin-10-ium perchlorate |
| InChIKey | VDNXOHCMBBOSPE-UHFFFAOYSA-M |
| SMILES | CC1=CC2=C(C=C1)[N+](=C3C=CC(=CC3=C2C4=C(C=C(C=C4C)C)C)C)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)