CAS 1216929-70-2 is the registry number for N-Benzyloxycarbonyl-4-(4-chlorophenyl-d4)-4-piperidinol. Offered by: TRC. Available pack sizes: 100mg, 10mg.
Benzyl 4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxypiperidine-1-carboxylate (CAS 1216929-70-2) is a chemical compound with the molecular formula C19H20ClNO3 and a molecular weight of 349.8 g/mol. IUPAC name: benzyl 4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: OACLBBGOZRXENL-YKVCKAMESA-N.
| Molecular formula | C19H20ClNO3 |
|---|---|
| Molecular weight | 349.8 g/mol |
| IUPAC name | benzyl 4-(4-chloro-2,3,5,6-tetradeuteriophenyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | OACLBBGOZRXENL-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2(CCN(CC2)C(=O)OCC3=CC=CC=C3)O)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)