CAS 12170-97-7 appears in our catalog under these names: Dichloro(2,6,10–dodecatriene–1,12–diyl)ruthenium(IV), DICHLORO((2,6,10-DODECATRIENE)-1,12-DIY&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 500MG.
Dichlororuthenium(2+);(2Z,6Z,10Z)-dodeca-2,6,10-triene (CAS 12170-97-7) is a chemical compound with the molecular formula C12H18Cl2Ru and a molecular weight of 334.2 g/mol. IUPAC name: dichlororuthenium(2+);(2Z,6Z,10Z)-dodeca-2,6,10-triene. InChIKey: HIFFVMAWJALNHN-ZQPXIAMJSA-L.
| Molecular formula | C12H18Cl2Ru |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | dichlororuthenium(2+);(2Z,6Z,10Z)-dodeca-2,6,10-triene |
| InChIKey | HIFFVMAWJALNHN-ZQPXIAMJSA-L |
| SMILES | [CH2-]/C=C\CC/C=C\CC/C=C\[CH2-].Cl[Ru+2]Cl |
Computed by PubChem (NCBI)