CAS 1217003-12-7 is the registry number for 5-Methylcotinine-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
5-(5-methyl-3-pyridinyl)-1-(trideuteriomethyl)pyrrolidin-2-one (CAS 1217003-12-7) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 193.26 g/mol. IUPAC name: 5-(5-methyl-3-pyridinyl)-1-(trideuteriomethyl)pyrrolidin-2-one. InChIKey: WHWUCUXJDGPSSV-BMSJAHLVSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 193.26 g/mol |
| IUPAC name | 5-(5-methyl-3-pyridinyl)-1-(trideuteriomethyl)pyrrolidin-2-one |
| InChIKey | WHWUCUXJDGPSSV-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(CCC1=O)C2=CN=CC(=C2)C |
Computed by PubChem (NCBI)