CAS 1217042-05-1 is the registry number for 5-Chloro Bifeprunox Mesylate. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-chloro-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one;methanesulfonic acid (CAS 1217042-05-1) is a chemical compound with the molecular formula C25H26ClN3O5S and a molecular weight of 516.0 g/mol. IUPAC name: 5-chloro-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one;methanesulfonic acid. InChIKey: GZUPEWPMZPFBNP-UHFFFAOYSA-N.
| Molecular formula | C25H26ClN3O5S |
|---|---|
| Molecular weight | 516.0 g/mol |
| IUPAC name | 5-chloro-7-[4-[(3-phenylphenyl)methyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one;methanesulfonic acid |
| InChIKey | GZUPEWPMZPFBNP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)O.C1CN(CCN1CC2=CC(=CC=C2)C3=CC=CC=C3)C4=CC(=CC5=C4OC(=O)N5)Cl |
Computed by PubChem (NCBI)