CAS 121709-23-7 is the registry number for 2alpha-Methyl Gibberellin A4. Offered by: TRC. Available pack sizes: 100mg.
2alpha-methyl-gibberellin A4 is an alkyl-gibberellin that is gibberellin A4 carrying an extra methyl substituent at position 2alpha (3alpha using gibbane skeletal numbering).
Source: ChEBI
| Molecular formula | C20H26O5 |
|---|---|
| Molecular weight | 346.4 g/mol |
| IUPAC name | (1R,2R,5R,8R,9S,10R,11S,12S,13R)-12-hydroxy-11,13-dimethyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadecane-9-carboxylic acid |
| InChIKey | ZEYLFUFMBZVHQE-WNXLCILNSA-N |
| SMILES | C[C@@H]1C[C@@]23[C@@H]4CC[C@@H]5C[C@]4(CC5=C)[C@H]([C@@H]2[C@@]([C@H]1O)(C(=O)O3)C)C(=O)O |
Computed by PubChem (NCBI)