CAS 1217195-61-3 appears in our catalog under these names: CP 31398 Dihydrochloride, CP-31398 dihydrochloride/ 99.53% (existing batch purity), CP 31398 dihydrochloride, CP 31398, CP-31398 2HCl 98%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
N-[2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (CAS 1217195-61-3) is a chemical compound with the molecular formula C22H28Cl2N4O and a molecular weight of 435.4 g/mol. IUPAC name: N-[2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride. InChIKey: WWIFDJIOGCGSBS-IVKCLRODSA-N.
| Molecular formula | C22H28Cl2N4O |
|---|---|
| Molecular weight | 435.4 g/mol |
| IUPAC name | N-[2-[(E)-2-(4-methoxyphenyl)ethenyl]quinazolin-4-yl]-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| InChIKey | WWIFDJIOGCGSBS-IVKCLRODSA-N |
| SMILES | CN(C)CCCNC1=NC(=NC2=CC=CC=C21)/C=C/C3=CC=C(C=C3)OC.Cl.Cl |
Computed by PubChem (NCBI)