CAS 1217226-46-4 appears in our catalog under these names: Nitrofurantoin-13C3, Nitrofurantoin-13C3, >95% (HPLC), Nitrofurantoin 13C3, Nitrofurantoin–13C3, 13C3-Nitrofurantoin, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 1mg, 5mg, 500ug, 500μg, 1x1ml, 1x5mg.
1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione (CAS 1217226-46-4) is a chemical compound with the molecular formula C8H6N4O5 and a molecular weight of 241.14 g/mol. IUPAC name: 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione. InChIKey: NXFQHRVNIOXGAQ-PZGYLZBDSA-N.
| Molecular formula | C8H6N4O5 |
|---|---|
| Molecular weight | 241.14 g/mol |
| IUPAC name | 1-[(E)-(5-nitrofuran-2-yl)methylideneamino]-(2,4,5-13C3)1,3-diazolidine-2,4-dione |
| InChIKey | NXFQHRVNIOXGAQ-PZGYLZBDSA-N |
| SMILES | [13CH2]1[13C](=O)N[13C](=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
Computed by PubChem (NCBI)