CAS 1217241-15-0 appears in our catalog under these names: 2-Phenyl-1-(4-(trifluoromethyl)phenyl)ethan-1-one O-(2-aminoethyl) oxime, 98%, Fluvoxamine Impurity 9 (Fluvoxamine EP Impurity J), 2-Phenyl-1-(4-(trifluoromethyl)phenyl)ethane 2-(Aminoethyl)oxime (Fluvoxamine Impurity). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
2-[(E)-[2-phenyl-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]oxyethanamine (CAS 1217241-15-0) is a chemical compound with the molecular formula C17H17F3N2O and a molecular weight of 322.32 g/mol. IUPAC name: 2-[(E)-[2-phenyl-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]oxyethanamine. InChIKey: VXZVMQOMRJLTTR-CJLVFECKSA-N.
| Molecular formula | C17H17F3N2O |
|---|---|
| Molecular weight | 322.32 g/mol |
| IUPAC name | 2-[(E)-[2-phenyl-1-[4-(trifluoromethyl)phenyl]ethylidene]amino]oxyethanamine |
| InChIKey | VXZVMQOMRJLTTR-CJLVFECKSA-N |
| SMILES | C1=CC=C(C=C1)C/C(=N\OCCN)/C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)