CAS 1217247-19-2 appears in our catalog under these names: (E/Z)-4,4’-Dihydroxy-N-desmethyl Tamoxifen, (E/Z)–4,4'–Dihydroxy–N–desmethyl Tamoxifen. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 1mg, 5mg.
4-[(Z)-1-(4-hydroxyphenyl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-en-2-yl]phenol (CAS 1217247-19-2) is a chemical compound with the molecular formula C25H27NO3 and a molecular weight of 389.5 g/mol. IUPAC name: 4-[(Z)-1-(4-hydroxyphenyl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-en-2-yl]phenol. InChIKey: JYBJJTCUEOUMEV-IZHYLOQSSA-N.
| Molecular formula | C25H27NO3 |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | 4-[(Z)-1-(4-hydroxyphenyl)-1-[4-[2-(methylamino)ethoxy]phenyl]but-1-en-2-yl]phenol |
| InChIKey | JYBJJTCUEOUMEV-IZHYLOQSSA-N |
| SMILES | CC/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCNC)/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)