CAS 121739-78-4 is the registry number for 2-(3-Nitrophenyl)thiazolo[5,4-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(3-nitrophenyl)-[1,3]thiazolo[5,4-b]pyridine (CAS 121739-78-4) is a chemical compound with the molecular formula C12H7N3O2S and a molecular weight of 257.27 g/mol. IUPAC name: 2-(3-nitrophenyl)-[1,3]thiazolo[5,4-b]pyridine. InChIKey: ZICJWVWVHPXPMK-UHFFFAOYSA-N.
| Molecular formula | C12H7N3O2S |
|---|---|
| Molecular weight | 257.27 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-[1,3]thiazolo[5,4-b]pyridine |
| InChIKey | ZICJWVWVHPXPMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=NC3=C(S2)N=CC=C3 |
Computed by PubChem (NCBI)