CAS 1217449-55-2 is the registry number for (1R)-1-(3-chloro-2-fluorophenyl)ethylamine, 98%. Offered by: AmBeed. Available pack sizes: 5g.
(1R)-1-(3-chloro-2-fluorophenyl)ethanamine (CAS 1217449-55-2) is a chemical compound with the molecular formula C8H9ClFN and a molecular weight of 173.61 g/mol. IUPAC name: (1R)-1-(3-chloro-2-fluorophenyl)ethanamine. InChIKey: SCEUCESYXQXKOY-RXMQYKEDSA-N.
| Molecular formula | C8H9ClFN |
|---|---|
| Molecular weight | 173.61 g/mol |
| IUPAC name | (1R)-1-(3-chloro-2-fluorophenyl)ethanamine |
| InChIKey | SCEUCESYXQXKOY-RXMQYKEDSA-N |
| SMILES | C[C@H](C1=C(C(=CC=C1)Cl)F)N |
Computed by PubChem (NCBI)