Products 1217451-85-8
CAS 1217451-85-8 appears in our catalog under these names: L-Theanine-d5 (N-ethyl-d5), 99 atom % D, min 98% Chemical Purity, L-Theanine-d5 (N-ethyl-d5), >95% (HPLC), L–Theanine–d5, L-Theanine-d5, 99.9%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 5mg, 1 mg, 5 mg.
(2S)-2-amino-5-oxo-5-(1,1,2,2,2-pentadeuterioethylamino)pentanoic acid (CAS 1217451-85-8) is a chemical compound with the molecular formula C7H14N2O3 and a molecular weight of 179.23 g/mol. IUPAC name: (2S)-2-amino-5-oxo-5-(1,1,2,2,2-pentadeuterioethylamino)pentanoic acid. InChIKey: DATAGRPVKZEWHA-HOWSKJRISA-N.
| Molecular formula | C7H14N2O3 |
|---|---|
| Molecular weight | 179.23 g/mol |
| IUPAC name | (2S)-2-amino-5-oxo-5-(1,1,2,2,2-pentadeuterioethylamino)pentanoic acid |
| InChIKey | DATAGRPVKZEWHA-HOWSKJRISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)