CAS 1217456-98-8 is the registry number for D-Homoarginine Hydrochloride. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;hydrochloride (CAS 1217456-98-8) is a chemical compound with the molecular formula C7H17ClN4O2 and a molecular weight of 224.69 g/mol. IUPAC name: (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;hydrochloride. InChIKey: YMKBVNVCKUYUDM-NUBCRITNSA-N.
| Molecular formula | C7H17ClN4O2 |
|---|---|
| Molecular weight | 224.69 g/mol |
| IUPAC name | (2R)-2-amino-6-(diaminomethylideneamino)hexanoic acid;hydrochloride |
| InChIKey | YMKBVNVCKUYUDM-NUBCRITNSA-N |
| SMILES | C(CCN=C(N)N)C[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)