Products 1217462-58-2
CAS 1217462-58-2 is the registry number for (S)–2–Azido–propionic acid cyclohexylammonium salt. Offered by: GLPBio. Available pack sizes: 100mg, 500mg.
(2S)-2-azidopropanoic acid;cyclohexanamine (CAS 1217462-58-2) is a chemical compound with the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. IUPAC name: (2S)-2-azidopropanoic acid;cyclohexanamine. InChIKey: CGKQKHCXMKZFEF-WNQIDUERSA-N.
| Molecular formula | C9H18N4O2 |
|---|---|
| Molecular weight | 214.27 g/mol |
| IUPAC name | (2S)-2-azidopropanoic acid;cyclohexanamine |
| InChIKey | CGKQKHCXMKZFEF-WNQIDUERSA-N |
| SMILES | C[C@@H](C(=O)O)N=[N+]=[N-].C1CCC(CC1)N |
Computed by PubChem (NCBI)