Products 1217465-10-5
CAS 1217465-10-5 appears in our catalog under these names: S-Metolachlor CGA 357704, S-Metolachlor Metabolite CGA 357704, Concentration: 10.0 µg/ml Solvent: Acetonitrile, S-Metolachlor Metabolite CGA 357704, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 100mg, 10mg, 1x10ml, 1x1ml.
(2S)-2-(2-ethyl-6-methyl-N-oxaloanilino)propanoic acid (CAS 1217465-10-5) is a chemical compound with the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. IUPAC name: (2S)-2-(2-ethyl-6-methyl-N-oxaloanilino)propanoic acid. InChIKey: IMFSUYMDPTXKCC-VIFPVBQESA-N.
| Molecular formula | C14H17NO5 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | (2S)-2-(2-ethyl-6-methyl-N-oxaloanilino)propanoic acid |
| InChIKey | IMFSUYMDPTXKCC-VIFPVBQESA-N |
| SMILES | CCC1=CC=CC(=C1N([C@@H](C)C(=O)O)C(=O)C(=O)O)C |
Computed by PubChem (NCBI)