Products 1217466-21-1
CAS 1217466-21-1 appears in our catalog under these names: GW 1929 hydrochloride, GW 1929 hydrochloride, GW1929 (hydrochloride). Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100mg, Get quote.
(2S)-2-(2-benzoylanilino)-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]propanoic acid;hydrochloride (CAS 1217466-21-1) is a chemical compound with the molecular formula C30H30ClN3O4 and a molecular weight of 532.0 g/mol. IUPAC name: (2S)-2-(2-benzoylanilino)-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]propanoic acid;hydrochloride. InChIKey: KXNKIKXTGRMLEY-YCBFMBTMSA-N.
| Molecular formula | C30H30ClN3O4 |
|---|---|
| Molecular weight | 532.0 g/mol |
| IUPAC name | (2S)-2-(2-benzoylanilino)-3-[4-[2-[methyl(pyridin-2-yl)amino]ethoxy]phenyl]propanoic acid;hydrochloride |
| InChIKey | KXNKIKXTGRMLEY-YCBFMBTMSA-N |
| SMILES | CN(CCOC1=CC=C(C=C1)C[C@@H](C(=O)O)NC2=CC=CC=C2C(=O)C3=CC=CC=C3)C4=CC=CC=N4.Cl |
Computed by PubChem (NCBI)