CAS 1217474-40-2 appears in our catalog under these names: NAS-181 dimesylate, 98%, NAS–181, NAS-181, NAS-181, 98%, 98%, NAS-181 (dimesylate), 96.37%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 100mg, 10mg, 50mg, 1mg, 5mg, 5 mg, 10 mg.
Methanesulfonic acid;(2R)-2-[[3-(morpholin-4-ylmethyl)-2H-chromen-8-yl]oxymethyl]morpholine (CAS 1217474-40-2) is a chemical compound with the molecular formula C21H34N2O10S2 and a molecular weight of 538.6 g/mol. IUPAC name: methanesulfonic acid;(2R)-2-[[3-(morpholin-4-ylmethyl)-2H-chromen-8-yl]oxymethyl]morpholine. InChIKey: WMRMIRRDPBKNMY-ZEECNFPPSA-N.
| Molecular formula | C21H34N2O10S2 |
|---|---|
| Molecular weight | 538.6 g/mol |
| IUPAC name | methanesulfonic acid;(2R)-2-[[3-(morpholin-4-ylmethyl)-2H-chromen-8-yl]oxymethyl]morpholine |
| InChIKey | WMRMIRRDPBKNMY-ZEECNFPPSA-N |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.C1CO[C@H](CN1)COC2=CC=CC3=C2OCC(=C3)CN4CCOCC4 |
Computed by PubChem (NCBI)