Products 1217487-29-0
CAS 1217487-29-0 is the registry number for 5-(2-(2,3-Dimethylbutan-2-yl)pyrimidin-4-yl)-4-methylthiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[2-(2,3-dimethylbutan-2-yl)pyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine (CAS 1217487-29-0) is a chemical compound with the molecular formula C14H20N4S and a molecular weight of 276.40 g/mol. IUPAC name: 5-[2-(2,3-dimethylbutan-2-yl)pyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine. InChIKey: FAEKJXRPINZLET-UHFFFAOYSA-N.
| Molecular formula | C14H20N4S |
|---|---|
| Molecular weight | 276.40 g/mol |
| IUPAC name | 5-[2-(2,3-dimethylbutan-2-yl)pyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine |
| InChIKey | FAEKJXRPINZLET-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C2=NC(=NC=C2)C(C)(C)C(C)C |
Computed by PubChem (NCBI)