CAS 1217500-70-3 is the registry number for 5-Formylpyridine-2-boronic acid, hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
(5-formyl-2-pyridinyl)boronic acid;hydrate (CAS 1217500-70-3) is a chemical compound with the molecular formula C6H8BNO4 and a molecular weight of 168.95 g/mol. IUPAC name: (5-formyl-2-pyridinyl)boronic acid;hydrate. InChIKey: BCLDLQBSWPNBNM-UHFFFAOYSA-N.
| Molecular formula | C6H8BNO4 |
|---|---|
| Molecular weight | 168.95 g/mol |
| IUPAC name | (5-formyl-2-pyridinyl)boronic acid;hydrate |
| InChIKey | BCLDLQBSWPNBNM-UHFFFAOYSA-N |
| SMILES | B(C1=NC=C(C=C1)C=O)(O)O.O |
Computed by PubChem (NCBI)