CAS 1217500-72-5 appears in our catalog under these names: 2-(4-Methoxybenzyloxy)pyrimidine-5-boronic acid, 96%, (2-((4-Methoxybenzyl)oxy)pyrimidin-5-yl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[2-[(4-methoxyphenyl)methoxy]pyrimidin-5-yl]boronic acid (CAS 1217500-72-5) is a chemical compound with the molecular formula C12H13BN2O4 and a molecular weight of 260.06 g/mol. IUPAC name: [2-[(4-methoxyphenyl)methoxy]pyrimidin-5-yl]boronic acid. InChIKey: DDOPLKCYKQDZCF-UHFFFAOYSA-N.
| Molecular formula | C12H13BN2O4 |
|---|---|
| Molecular weight | 260.06 g/mol |
| IUPAC name | [2-[(4-methoxyphenyl)methoxy]pyrimidin-5-yl]boronic acid |
| InChIKey | DDOPLKCYKQDZCF-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(N=C1)OCC2=CC=C(C=C2)OC)(O)O |
Computed by PubChem (NCBI)