CAS 1217500-76-9 appears in our catalog under these names: 5-Acrylamido-2-(hydroxymethyl)phenylboronic acid, 96%, 5-Acrylamido-2-(hydroxymethyl)phenylboronic acid, 96% +(stabilized with TBC). Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg.
[2-(hydroxymethyl)-5-(prop-2-enoylamino)phenyl]boronic acid (CAS 1217500-76-9) is a chemical compound with the molecular formula C10H12BNO4 and a molecular weight of 221.02 g/mol. IUPAC name: [2-(hydroxymethyl)-5-(prop-2-enoylamino)phenyl]boronic acid. InChIKey: SIPPDIZUHBQKKL-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO4 |
|---|---|
| Molecular weight | 221.02 g/mol |
| IUPAC name | [2-(hydroxymethyl)-5-(prop-2-enoylamino)phenyl]boronic acid |
| InChIKey | SIPPDIZUHBQKKL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)NC(=O)C=C)CO)(O)O |
Computed by PubChem (NCBI)