CAS 1217500-99-6 appears in our catalog under these names: 4-(Isobutylsulfonyl)phenylboronic acid, 97%, (4-(Isobutylsulfonyl)phenyl)boronic acid 97%, 4-(Isobutylsulfonyl)phenylboronic acid, 97%, 97%, (4-(Isobutylsulfonyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[4-(2-methylpropylsulfonyl)phenyl]boronic acid (CAS 1217500-99-6) is a chemical compound with the molecular formula C10H15BO4S and a molecular weight of 242.10 g/mol. IUPAC name: [4-(2-methylpropylsulfonyl)phenyl]boronic acid. InChIKey: WGYQGDKMBFOTGS-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4S |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | [4-(2-methylpropylsulfonyl)phenyl]boronic acid |
| InChIKey | WGYQGDKMBFOTGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)CC(C)C)(O)O |
Computed by PubChem (NCBI)