CAS 1217501-03-5 appears in our catalog under these names: 4-(Cyclopropylmethylthio)phenylboronic acid, 97%, 4-(Cyclopropylmethylthio)phenylboronic acid, 95%, 95%, (4-((Cyclopropylmethyl)thio)phenyl)boronic acid, 95%, (4-((Cyclopropylmethyl)thio)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
[4-(cyclopropylmethylsulfanyl)phenyl]boronic acid (CAS 1217501-03-5) is a chemical compound with the molecular formula C10H13BO2S and a molecular weight of 208.09 g/mol. IUPAC name: [4-(cyclopropylmethylsulfanyl)phenyl]boronic acid. InChIKey: SKUDUPVJZBDKND-UHFFFAOYSA-N.
| Molecular formula | C10H13BO2S |
|---|---|
| Molecular weight | 208.09 g/mol |
| IUPAC name | [4-(cyclopropylmethylsulfanyl)phenyl]boronic acid |
| InChIKey | SKUDUPVJZBDKND-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)SCC2CC2)(O)O |
Computed by PubChem (NCBI)