Products 1217501-06-8

CAS 1217501-06-8 is the registry number for 4-(Cyclopropylsulfinyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

(4-cyclopropylsulfinylphenyl)boronic acid (CAS 1217501-06-8) is a chemical compound with the molecular formula C9H11BO3S and a molecular weight of 210.06 g/mol. IUPAC name: (4-cyclopropylsulfinylphenyl)boronic acid. InChIKey: UVAFNQYMJVLTNA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BO3S
Molecular weight210.06 g/mol
IUPAC name(4-cyclopropylsulfinylphenyl)boronic acid
InChIKeyUVAFNQYMJVLTNA-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S(=O)C2CC2)(O)O

Computed by PubChem (NCBI)