CAS 1217501-06-8 is the registry number for 4-(Cyclopropylsulfinyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
(4-cyclopropylsulfinylphenyl)boronic acid (CAS 1217501-06-8) is a chemical compound with the molecular formula C9H11BO3S and a molecular weight of 210.06 g/mol. IUPAC name: (4-cyclopropylsulfinylphenyl)boronic acid. InChIKey: UVAFNQYMJVLTNA-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3S |
|---|---|
| Molecular weight | 210.06 g/mol |
| IUPAC name | (4-cyclopropylsulfinylphenyl)boronic acid |
| InChIKey | UVAFNQYMJVLTNA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)C2CC2)(O)O |
Computed by PubChem (NCBI)