CAS 1217501-25-1 is the registry number for 2,6-Dimethoxypyridine-3,5-diboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(5-borono-2,6-dimethoxy-3-pyridinyl)boronic acid (CAS 1217501-25-1) is a chemical compound with the molecular formula C7H11B2NO6 and a molecular weight of 226.79 g/mol. IUPAC name: (5-borono-2,6-dimethoxy-3-pyridinyl)boronic acid. InChIKey: GNVINSUSNLQQHZ-UHFFFAOYSA-N.
| Molecular formula | C7H11B2NO6 |
|---|---|
| Molecular weight | 226.79 g/mol |
| IUPAC name | (5-borono-2,6-dimethoxy-3-pyridinyl)boronic acid |
| InChIKey | GNVINSUSNLQQHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1OC)OC)B(O)O)(O)O |
Computed by PubChem (NCBI)