Products 1217501-25-1

CAS 1217501-25-1 is the registry number for 2,6-Dimethoxypyridine-3,5-diboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g.

Structural formula: {0} (CAS {1})

(5-borono-2,6-dimethoxy-3-pyridinyl)boronic acid (CAS 1217501-25-1) is a chemical compound with the molecular formula C7H11B2NO6 and a molecular weight of 226.79 g/mol. IUPAC name: (5-borono-2,6-dimethoxy-3-pyridinyl)boronic acid. InChIKey: GNVINSUSNLQQHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11B2NO6
Molecular weight226.79 g/mol
IUPAC name(5-borono-2,6-dimethoxy-3-pyridinyl)boronic acid
InChIKeyGNVINSUSNLQQHZ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1OC)OC)B(O)O)(O)O

Computed by PubChem (NCBI)