CAS 1217501-29-5 appears in our catalog under these names: 2-Amino-4-(imino(methoxy)methyl)phenylboronic acid hydrochloride, 95%, (2-Amino-4-(imino(methoxy)methyl)phenyl)boronic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[2-amino-4-(C-methoxycarbonimidoyl)phenyl]boronic acid;hydrochloride (CAS 1217501-29-5) is a chemical compound with the molecular formula C8H12BClN2O3 and a molecular weight of 230.46 g/mol. IUPAC name: [2-amino-4-(C-methoxycarbonimidoyl)phenyl]boronic acid;hydrochloride. InChIKey: KRJBXNLUTWEQPI-UHFFFAOYSA-N.
| Molecular formula | C8H12BClN2O3 |
|---|---|
| Molecular weight | 230.46 g/mol |
| IUPAC name | [2-amino-4-(C-methoxycarbonimidoyl)phenyl]boronic acid;hydrochloride |
| InChIKey | KRJBXNLUTWEQPI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=N)OC)N)(O)O.Cl |
Computed by PubChem (NCBI)