CAS 1217501-45-5 is the registry number for 1-(2,6-Dichlorophenyl)pyrazole-4-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[1-(2,6-dichlorophenyl)pyrazol-4-yl]boronic acid (CAS 1217501-45-5) is a chemical compound with the molecular formula C9H7BCl2N2O2 and a molecular weight of 256.88 g/mol. IUPAC name: [1-(2,6-dichlorophenyl)pyrazol-4-yl]boronic acid. InChIKey: AINBYBFLMMGXBO-UHFFFAOYSA-N.
| Molecular formula | C9H7BCl2N2O2 |
|---|---|
| Molecular weight | 256.88 g/mol |
| IUPAC name | [1-(2,6-dichlorophenyl)pyrazol-4-yl]boronic acid |
| InChIKey | AINBYBFLMMGXBO-UHFFFAOYSA-N |
| SMILES | B(C1=CN(N=C1)C2=C(C=CC=C2Cl)Cl)(O)O |
Computed by PubChem (NCBI)