CAS 1217548-81-6 is the registry number for Pregabalin Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide (CAS 1217548-81-6) is a chemical compound with the molecular formula C26H27N3O and a molecular weight of 397.5 g/mol. IUPAC name: N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide. InChIKey: LUDJVVHYLPTLOW-IYNDAXALSA-N.
| Molecular formula | C26H27N3O |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | N-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl]benzamide |
| InChIKey | LUDJVVHYLPTLOW-IYNDAXALSA-N |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](C3=CC=NC4=CC=CC=C34)NC(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)