Products 1217605-54-3
CAS 1217605-54-3 appears in our catalog under these names: (S)–2–Aminobutyramide–d3 Hydrochloride, (S)-2-Aminobutyramide-d3 (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg.
(2S)-2-amino-4,4,4-trideuteriobutanamide;hydrochloride (CAS 1217605-54-3) is a chemical compound with the molecular formula C4H11ClN2O and a molecular weight of 141.61 g/mol. IUPAC name: (2S)-2-amino-4,4,4-trideuteriobutanamide;hydrochloride. InChIKey: HDBMIDJFXOYCGK-YUKGPTQOSA-N.
| Molecular formula | C4H11ClN2O |
|---|---|
| Molecular weight | 141.61 g/mol |
| IUPAC name | (2S)-2-amino-4,4,4-trideuteriobutanamide;hydrochloride |
| InChIKey | HDBMIDJFXOYCGK-YUKGPTQOSA-N |
| SMILES | [2H]C([2H])([2H])C[C@@H](C(=O)N)N.Cl |
Computed by PubChem (NCBI)