Products 1217625-62-1
CAS 1217625-62-1 appears in our catalog under these names: Colchicine-d3, >95% (HPLC), Colchicine-d3 (N-acetyl-d3), 99 atom % D, min 98% Chemical Purity, Colchicine-d3 (N-acetyl-d3), Colchicine-d3, 99.24%. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,01g, 0,005g, 2mg, 25mg, 1 mg.
2,2,2-trideuterio-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide (CAS 1217625-62-1) is a chemical compound with the molecular formula C22H25NO6 and a molecular weight of 402.5 g/mol. IUPAC name: 2,2,2-trideuterio-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide. InChIKey: IAKHMKGGTNLKSZ-AVSFSGARSA-N.
| Molecular formula | C22H25NO6 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide |
| InChIKey | IAKHMKGGTNLKSZ-AVSFSGARSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N[C@H]1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Colchicine-d3, orb3138866