CAS 1217645-10-7 appears in our catalog under these names: Fmoc-d-dab(fmoc)-oh, 95%, Fmoc-D-Dab(Fmoc)-OH, Fmoc-D-Dab(Fmoc)-OH 95%, Fmoc-D-Dab(Fmoc)-OH, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g.
(2R)-2,4-bis(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 1217645-10-7) is a chemical compound with the molecular formula C34H30N2O6 and a molecular weight of 562.6 g/mol. IUPAC name: (2R)-2,4-bis(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: ALZDIZDLDRWFAC-WJOKGBTCSA-N.
| Molecular formula | C34H30N2O6 |
|---|---|
| Molecular weight | 562.6 g/mol |
| IUPAC name | (2R)-2,4-bis(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | ALZDIZDLDRWFAC-WJOKGBTCSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC[C@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)