CAS 1217674-10-6 appears in our catalog under these names: SB 258719 hydrochloride, SB 258719 hydrochloride, SB 258719 (hydrochloride). Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 10mg, 50mg, 25mg, 100mg, Get quote.
N,3-dimethyl-N-[(2R)-4-(4-methylpiperidin-1-yl)butan-2-yl]benzenesulfonamide;hydrochloride (CAS 1217674-10-6) is a chemical compound with the molecular formula C18H31ClN2O2S and a molecular weight of 375.0 g/mol. IUPAC name: N,3-dimethyl-N-[(2R)-4-(4-methylpiperidin-1-yl)butan-2-yl]benzenesulfonamide;hydrochloride. InChIKey: UIZKHTBWJSUGOV-UNTBIKODSA-N.
| Molecular formula | C18H31ClN2O2S |
|---|---|
| Molecular weight | 375.0 g/mol |
| IUPAC name | N,3-dimethyl-N-[(2R)-4-(4-methylpiperidin-1-yl)butan-2-yl]benzenesulfonamide;hydrochloride |
| InChIKey | UIZKHTBWJSUGOV-UNTBIKODSA-N |
| SMILES | CC1CCN(CC1)CC[C@@H](C)N(C)S(=O)(=O)C2=CC=CC(=C2)C.Cl |
Computed by PubChem (NCBI)