CAS 1217699-64-3 is the registry number for rac-(2R,4S)-1-((tert-Butoxy)carbonyl)-4-hydroxypiperidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
(2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate (CAS 1217699-64-3) is a chemical compound with the molecular formula C11H18NO5- and a molecular weight of 244.26 g/mol. IUPAC name: (2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate. InChIKey: GCAZZUFIDGXTDA-JGVFFNPUSA-M.
| Molecular formula | C11H18NO5- |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | (2R,4S)-4-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-carboxylate |
| InChIKey | GCAZZUFIDGXTDA-JGVFFNPUSA-M |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@@H]1C(=O)[O-])O |
Computed by PubChem (NCBI)