CAS 1217706-03-0 appears in our catalog under these names: (S)-tert-Butyl 2-(dimethylcarbamoyl)piperazine-1-carboxylate hydrochloride, 95%, (S)–tert–Butyl 2–(dimethylcarbamoyl)piperazine–1–carboxylate hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
Tert-butyl (2S)-2-(dimethylcarbamoyl)piperazine-1-carboxylate;hydrochloride (CAS 1217706-03-0) is a chemical compound with the molecular formula C12H24ClN3O3 and a molecular weight of 293.79 g/mol. IUPAC name: tert-butyl (2S)-2-(dimethylcarbamoyl)piperazine-1-carboxylate;hydrochloride. InChIKey: LBCLBCRUJZYOOS-FVGYRXGTSA-N.
| Molecular formula | C12H24ClN3O3 |
|---|---|
| Molecular weight | 293.79 g/mol |
| IUPAC name | tert-butyl (2S)-2-(dimethylcarbamoyl)piperazine-1-carboxylate;hydrochloride |
| InChIKey | LBCLBCRUJZYOOS-FVGYRXGTSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC[C@H]1C(=O)N(C)C.Cl |
Computed by PubChem (NCBI)