Products 1217709-85-7
CAS 1217709-85-7 appears in our catalog under these names: Repaglinide-d5, (S)-(+)-Repaglinide-d5 (ethoxy-d5), 99 atom % D, min 98% Chemical Purity, Repaglinide-ethyl-d5, >95% (HPLC), Repaglinide D5, Repaglinide–d5. Offered by: Chemat Brand, CDN, TRC, TargetMol, GLPBio. Available pack sizes: on request, 0,01g, 0,005g, 10mg, 1mg, 5mg, 10 mg, 25 mg.
4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid (CAS 1217709-85-7) is a chemical compound with the molecular formula C27H36N2O4 and a molecular weight of 457.6 g/mol. IUPAC name: 4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid. InChIKey: FAEKWTJYAYMJKF-NTSVIFQKSA-N.
| Molecular formula | C27H36N2O4 |
|---|---|
| Molecular weight | 457.6 g/mol |
| IUPAC name | 4-[2-[[(1S)-3-methyl-1-(2-piperidin-1-ylphenyl)butyl]amino]-2-oxoethyl]-2-(1,1,2,2,2-pentadeuterioethoxy)benzoic acid |
| InChIKey | FAEKWTJYAYMJKF-NTSVIFQKSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=C(C=CC(=C1)CC(=O)N[C@@H](CC(C)C)C2=CC=CC=C2N3CCCCC3)C(=O)O |
Computed by PubChem (NCBI)