CAS 1217756-62-1 appears in our catalog under these names: (2R)-2-(3-Chlorophenyl)pyrrolidine, 95%, (R)–2–(3–Chlorophenyl)pyrrolidine, (R)-2-(3-Chlorophenyl)pyrrolidine 95%, (R)-2-(3-Chlorophenyl)pyrrolidine, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg.
(2R)-2-(3-chlorophenyl)pyrrolidine (CAS 1217756-62-1) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: (2R)-2-(3-chlorophenyl)pyrrolidine. InChIKey: SRTPGDGQKPCDMC-SNVBAGLBSA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2R)-2-(3-chlorophenyl)pyrrolidine |
| InChIKey | SRTPGDGQKPCDMC-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)