Products 1217832-61-5

CAS 1217832-61-5 is the registry number for (S)-(-)-Blebbistatin O-Benzoate. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 50mg, 5mg, 10mg.

Structural formula: {0} (CAS {1})

[(3aS)-6-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate (CAS 1217832-61-5) is a chemical compound with the molecular formula C25H20N2O3 and a molecular weight of 396.4 g/mol. IUPAC name: [(3aS)-6-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate. InChIKey: ICIURMLAMQGRRU-RUZDIDTESA-N.

Identity
Molecular formulaC25H20N2O3
Molecular weight396.4 g/mol
IUPAC name[(3aS)-6-methyl-4-oxo-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-3a-yl] benzoate
InChIKeyICIURMLAMQGRRU-RUZDIDTESA-N
SMILESCC1=CC2=C(C=C1)N=C3[C@](C2=O)(CCN3C4=CC=CC=C4)OC(=O)C5=CC=CC=C5

Computed by PubChem (NCBI)