Products 1217846-45-1
CAS 1217846-45-1 is the registry number for N-[(1R)-2-Hydroxy-1-[(3-phenylphenyl)methyl]ethyl](tert-butoxy)carboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(2R)-1-hydroxy-3-(3-phenylphenyl)propan-2-yl]carbamate (CAS 1217846-45-1) is a chemical compound with the molecular formula C20H25NO3 and a molecular weight of 327.4 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-3-(3-phenylphenyl)propan-2-yl]carbamate. InChIKey: SQKKTMQJOAKSPU-GOSISDBHSA-N.
| Molecular formula | C20H25NO3 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-3-(3-phenylphenyl)propan-2-yl]carbamate |
| InChIKey | SQKKTMQJOAKSPU-GOSISDBHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC(=CC=C1)C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)