CAS 1217852-49-7 appears in our catalog under these names: Fmoc-l-selenomethionine, 95%, Fmoc-SeMet-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(methylselanyl)butanoic acid, 98%, 98%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(methylselanyl)butanoic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylselanylbutanoic acid (CAS 1217852-49-7) is a chemical compound with the molecular formula C20H21NO4Se and a molecular weight of 418.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylselanylbutanoic acid. InChIKey: MOIJGLAOGAWHTN-SFHVURJKSA-N.
| Molecular formula | C20H21NO4Se |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylselanylbutanoic acid |
| InChIKey | MOIJGLAOGAWHTN-SFHVURJKSA-N |
| SMILES | C[Se]CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)