CAS 1217853-98-9 appears in our catalog under these names: Benzyl (2R)-3-N,N-Dibenzylamino-2-fluoropropanoate-13C3, Benzyl(2R)-3-N,N-dibenzylamino-2-fluoropropanoate-13C3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 10 mg, 1 mg.
Benzyl (2R)-3-(dibenzylamino)-2-fluoro(1,2,3-13C3)propanoate (CAS 1217853-98-9) is a chemical compound with the molecular formula C24H24FNO2 and a molecular weight of 380.4 g/mol. IUPAC name: benzyl (2R)-3-(dibenzylamino)-2-fluoro(1,2,3-13C3)propanoate. InChIKey: LWZWKAWTHAMCLH-LTEZOHICSA-N.
| Molecular formula | C24H24FNO2 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | benzyl (2R)-3-(dibenzylamino)-2-fluoro(1,2,3-13C3)propanoate |
| InChIKey | LWZWKAWTHAMCLH-LTEZOHICSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)[13CH2][13C@H]([13C](=O)OCC3=CC=CC=C3)F |
Computed by PubChem (NCBI)