Products 1217856-23-9
CAS 1217856-23-9 is the registry number for 1-(1,1-Dimethylethyl) (3S)-3-(3-carboxyphenyl)-1-piperidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]benzoic acid (CAS 1217856-23-9) is a chemical compound with the molecular formula C17H23NO4 and a molecular weight of 305.4 g/mol. IUPAC name: 3-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]benzoic acid. InChIKey: OWIOBHQKBBEWRW-CQSZACIVSA-N.
| Molecular formula | C17H23NO4 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 3-[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-3-yl]benzoic acid |
| InChIKey | OWIOBHQKBBEWRW-CQSZACIVSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)