CAS 1217862-67-3 is the registry number for 5-(Aminomethyl)-n-phenyl-1,3,4-thiadiazole-2-carboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-(aminomethyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide (CAS 1217862-67-3) is a chemical compound with the molecular formula C10H10N4OS and a molecular weight of 234.28 g/mol. IUPAC name: 5-(aminomethyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide. InChIKey: SJKJCOIGLQAIJR-UHFFFAOYSA-N.
| Molecular formula | C10H10N4OS |
|---|---|
| Molecular weight | 234.28 g/mol |
| IUPAC name | 5-(aminomethyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| InChIKey | SJKJCOIGLQAIJR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=NN=C(S2)CN |
Computed by PubChem (NCBI)