CAS 1217863-70-1 appears in our catalog under these names: 2-[Dimethyl(3-pyridyl)silyl]benzyl alcohol, 95%, (2-(Dimethyl(pyridin-3-yl)silyl)phenyl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
[2-[dimethyl(pyridin-3-yl)silyl]phenyl]methanol (CAS 1217863-70-1) is a chemical compound with the molecular formula C14H17NOSi and a molecular weight of 243.38 g/mol. IUPAC name: [2-[dimethyl(pyridin-3-yl)silyl]phenyl]methanol. InChIKey: WDXRXEGRGZUQCL-UHFFFAOYSA-N.
| Molecular formula | C14H17NOSi |
|---|---|
| Molecular weight | 243.38 g/mol |
| IUPAC name | [2-[dimethyl(pyridin-3-yl)silyl]phenyl]methanol |
| InChIKey | WDXRXEGRGZUQCL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C1=CN=CC=C1)C2=CC=CC=C2CO |
Computed by PubChem (NCBI)