CAS 1217980-22-7 appears in our catalog under these names: 4,4'–(9,9–Dimethyl–9H–fluorene–2,7–diyl)dipyridine, 4,4'-(9,9-Dimethyl-9H-fluorene-2,7-diyl)dipyridine, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg.
4-(9,9-dimethyl-7-pyridin-4-ylfluoren-2-yl)pyridine (CAS 1217980-22-7) is a chemical compound with the molecular formula C25H20N2 and a molecular weight of 348.4 g/mol. IUPAC name: 4-(9,9-dimethyl-7-pyridin-4-ylfluoren-2-yl)pyridine. InChIKey: XEXAUYADAWIBAP-UHFFFAOYSA-N.
| Molecular formula | C25H20N2 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4-(9,9-dimethyl-7-pyridin-4-ylfluoren-2-yl)pyridine |
| InChIKey | XEXAUYADAWIBAP-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C3=CC=NC=C3)C4=C1C=C(C=C4)C5=CC=NC=C5)C |
Computed by PubChem (NCBI)